BD8865031
6-Chloro-1H-pyrazolo[4,3-c]pyridine , 98% , 1206979-33-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB41.60 | In Stock |
|
| 1g | RMB92.80 | In Stock |
|
| 5g | RMB457.60 | In Stock |
|
| 10g | RMB883.20 | In Stock |
|
| 25g | RMB1979.20 | In Stock |
|
| 100g | RMB6372.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 358℃ |
| Density | 1.531 |
| Flash point: | 201℃ |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder |
| pka | 10.46±0.40(Predicted) |
| color | Yellow |
| InChI | InChI=1S/C6H4ClN3/c7-6-1-5-4(2-8-6)3-9-10-5/h1-3H,(H,9,10) |
| InChIKey | AAJIQIWPVIWCGA-UHFFFAOYSA-N |
| SMILES | C1=NC(Cl)=CC2NN=CC1=2 |
| CAS DataBase Reference | 1206979-33-0 |
Description and Uses
Used as a pharmaceutical intermediate for laboratory research and development.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | 3 |
| HS Code | 2933790090 |

![6-Chloro-1H-pyrazolo[4,3-c]pyridine](https://img.chemicalbook.com/CAS/GIF/1206979-33-0.gif)

![6-Chloro-2-methylimidazo[1,2-b]pyridazine](https://img.chemicalbook.com/CAS/GIF/14793-00-1.gif)

![6-Methyl-1H-pyrrolo[2,3-b]pyridine](https://img.chemicalbook.com/CAS/GIF/824-51-1.gif)