BD8873431
(S)-tert-Butyl methyl(pyrrolidin-3-yl)carbamate , 97% , 169750-01-0
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB84.80 | In Stock |
|
| 250mg | RMB140.00 | In Stock |
|
| 1g | RMB354.40 | In Stock |
|
| 5g | RMB1095.20 | In Stock |
|
| 10g | RMB1985.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 268℃ |
| Density | 1.03 |
| Flash point: | 116℃ |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 9.85±0.10(Predicted) |
| Appearance | Colorless to light yellow Liquid |
| optical activity | Consistent with structure |
| InChI | InChI=1S/C10H20N2O2/c1-10(2,3)14-9(13)12(4)8-5-6-11-7-8/h8,11H,5-7H2,1-4H3/t8-/m0/s1 |
| InChIKey | XYKYUXYNQDXZTD-QMMMGPOBSA-N |
| SMILES | C(OC(C)(C)C)(=O)N(C)[C@H]1CCNC1 |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| HS Code | 2933998090 |



![tert-Butyl3,6-diazabicyclo[3.2.0]heptane-6-carboxylate](https://img.chemicalbook.com/CAS/GIF/122848-57-1.gif)
![1-Boc-octahydropyrrolo[3,4-b]pyridine](https://img.chemicalbook.com/CAS/GIF/159877-36-8.gif)
![tert-Butylhexahydropyrrolo[3,2-b]pyrrole-1(2H)-carboxylate](https://img.chemicalbook.com/CAS/GIF/885277-81-6.gif)
![6-Boc-2,6-diazaspiro[4.5]decane](https://img.chemicalbook.com/CAS/GIF/960294-16-0.gif)
![tert-Butyl1,7-diazaspiro[4.4]nonane-1-carboxylate](https://img.chemicalbook.com/CAS/GIF/885268-47-3.gif)