BD8876731
Methyl 2-bromo-4-chlorobenzoate , 98% , 57381-62-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB69.60 | In Stock |
|
| 10g | RMB134.40 | In Stock |
|
| 25g | RMB290.40 | In Stock |
|
| 100g | RMB1077.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 268.8±20.0 °C(Predicted) |
| Density | 1.604±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Light yellow |
| InChI | InChI=1S/C8H6BrClO2/c1-12-8(11)6-3-2-5(10)4-7(6)9/h2-4H,1H3 |
| InChIKey | BIFARHLBYAKSSN-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC=C(Cl)C=C1Br |
Description and Uses
Methyl 2-broMo-4-chlorobenzoate is a carboxylic acid ester organic compound used in organic synthesis reactions.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| HS Code | 2916310090 |
