BD8913647
(3S,4R)-tert-Butyl4-amino-3-fluoropiperidine-1-carboxylate , 98% , 907544-20-1
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB700.00 | In Stock |
|
| 250mg | RMB1189.60 | In Stock |
|
| 1g | RMB2736.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 285.6±40.0 °C(Predicted) |
| Density | 1.11±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C(protect from light) |
| pka | 8.88±0.40(Predicted) |
| Appearance | Colorless to off-white Solid-Liquid Mixture |
| InChI | InChI=1S/C10H19FN2O2/c1-10(2,3)15-9(14)13-5-4-8(12)7(11)6-13/h7-8H,4-6,12H2,1-3H3/t7-,8+/m0/s1 |
| InChIKey | ZQRYPCAUVKVMLZ-JGVFFNPUSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CC[C@@H](N)[C@@H](F)C1 |
| CAS DataBase Reference | 907544-20-1 |
Description and Uses
(3S,4R)-4-Amino-3-fluoropiperidine-1-carboxylic Acid tert-Butyl Ester is the derivative of Quinine (Q694000) which is the primary alkaloid of various species of Cinchona (Rubiaceae). Optical isomer of Quinidine. Antimalarial; muscle relaxant (skeletal).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H312 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P280-P302+P352-P312-P322-P363-P501 |







