BD8925355
2,6-Bis(trifluoromethyl)benzoicacid , 98% , 24821-22-5
CAS NO.:24821-22-5
Empirical Formula: C9H4F6O2
Molecular Weight: 258.12
MDL number: MFCD00000376
EINECS: 246-479-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB145.60 | In Stock |
|
| 5g | RMB429.60 | In Stock |
|
| 25g | RMB1919.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 138-140 °C (lit.) |
| Boiling point: | 220℃ |
| Density | 1.527 |
| Flash point: | 87℃ |
| storage temp. | Store at room temperature |
| form | Crystalline Powder |
| pka | 2.27±0.50(Predicted) |
| color | White |
| Water Solubility | Soluble in water. |
| BRN | 2057459 |
| InChI | 1S/C9H4F6O2/c10-8(11,12)4-2-1-3-5(9(13,14)15)6(4)7(16)17/h1-3H,(H,16,17) |
| InChIKey | XZNLSDPNMNWCRE-UHFFFAOYSA-N |
| SMILES | OC(=O)c1c(cccc1C(F)(F)F)C(F)(F)F |
| CAS DataBase Reference | 24821-22-5(CAS DataBase Reference) |
Description and Uses
2,6-Bis(trifluoromethyl)benzoic acid is a useful synthetic intermediate, and is a derivative of Benzoic acid (B203900). 2,6-Bis(trifluoromethyl)benzoic acid has also been identified as a chemical hybridizing agent in wheat.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




