BD8934931
3-Aminoisonicotinaldehyde , 95% , 55279-29-3
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB105.60 | In Stock |
|
| 250mg | RMB189.60 | In Stock |
|
| 1g | RMB513.60 | In Stock |
|
| 5g | RMB1714.40 | In Stock |
|
| 10g | RMB2914.40 | In Stock |
|
| 25g | RMB5829.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ca 92℃ |
| Boiling point: | 333.3±27.0 °C(Predicted) |
| Density | 1.264±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C |
| pka | 4.19±0.18(Predicted) |
| form | solid |
| Appearance | Light yellow to yellow Solid |
| Water Solubility | Slightly soluble in water. |
| Sensitive | Air Sensitive |
| InChI | InChI=1S/C6H6N2O/c7-6-3-8-2-1-5(6)4-9/h1-4H,7H2 |
| InChIKey | NDEGFXFYOKVWAK-UHFFFAOYSA-N |
| SMILES | C1=NC=CC(C=O)=C1N |
| CAS DataBase Reference | 55279-29-3(CAS DataBase Reference) |
Description and Uses
3-Aminopyridine-4-carboxaldehyde is used as pharmaceutical intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2933399990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







