BD8943231
4-(Dimethylamino)phenol , 97% , 619-60-3
CAS NO.：619-60-3
Empirical Formula: C8H11NO
Molecular Weight: 137.18
MDL number: MFCD01707548
EINECS: 210-604-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB50.40 | In Stock |
|
| 5g | RMB185.60 | In Stock |
|
| 10g | RMB348.00 | In Stock |
|
| 25g | RMB825.60 | In Stock |
|
| 100g | RMB2887.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 138-141℃ |
| Boiling point: | 260℃ |
| Density | 1.089 |
| refractive index | 1.5560 (estimate) |
| Flash point: | 136℃ |
| storage temp. | Keep in dark place,Sealed in dry,Store in freezer, under -20°C |
| form | solid |
| pka | 10.11±0.13(Predicted) |
| color | Off-white |
| InChI | InChI=1S/C8H11NO/c1-9(2)7-3-5-8(10)6-4-7/h3-6,10H,1-2H3 |
| InChIKey | JVVRCYWZTJLJSG-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(N(C)C)C=C1 |
Description and Uses
4-(Dimethylamino)phenol increases the extracellular lactate dehydrogenase (LDH) without markedly affecting gluconeogenesis. 4-(Dimethylamino)phenol cannot decreases the ATP content until the membrane becomes permeable to LDH[1].
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H302-H319-H315 |
| Precautionary statements | P264-P270-P301+P312-P330-P501-P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| RIDADR | UN2928 |
| RTECS | US9230000 |
| HazardClass | 6.1, 8 |
| HS Code | 2921490090 |
| Excepted Quantities | Max Inner Pack (1g or 1ml) and Max Outer Pack (300g or 300ml) |
