BD8961331
1-((2R,3R,4R,5R)-5-((Bis(4-methoxyphenyl)(phenyl)methoxy)methyl)-4-hydroxy-3-methoxytetrahydrofuran-2-yl)pyrimidine-2,4(1H,3H)-dione , 95% , 103285-22-9
CAS NO.:103285-22-9
Empirical Formula: C31H32N2O8
Molecular Weight: 560.59
MDL number: MFCD00274123
EINECS: 2017-001-1
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB58.40 | In Stock |
|
| 250mg | RMB87.20 | In Stock |
|
| 1g | RMB220.80 | In Stock |
|
| 5g | RMB731.20 | In Stock |
|
| 10g | RMB1210.40 | In Stock |
|
| 25g | RMB2523.20 | In Stock |
|
| 100g | RMB8348.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Density | 1.35±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Soluble in acetonitrile |
| pka | 9.39±0.10(Predicted) |
| form | Powder |
| color | White to Pale Yellow |
| InChIKey | MFDHAVFJDSRPKC-JSEYUTSUNA-N |
| SMILES | O(C(C1=CC=C(OC)C=C1)(C1=CC=C(OC)C=C1)C1=CC=CC=C1)C[C@H]1O[C@@H](N2C=CC(=O)NC2=O)[C@H](OC)[C@@H]1O |&1:25,27,36,39,r| |
Description and Uses
5’-O-(Dimethoxytrityl)-2’-O-methyluridine is a potential therapeutic agent. Also, it is a reagent used in the synthesis of 2’-modified-4’-thioRNA.






