BD8967131
1,1-Dioxo-isothiazolidine , 95% , 5908-62-3
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB195.20 | In Stock |
|
| 1g | RMB494.40 | In Stock |
|
| 5g | RMB1701.60 | In Stock |
|
| 10g | RMB3024.80 | In Stock |
|
| 25g | RMB5747.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 145-146 °C |
| Boiling point: | 128-132 °C(Press: 0.18 Torr) |
| Density | 1.326±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 11.52±0.20(Predicted) |
| form | liquid |
| color | Colorless to light yellow |
| InChI | InChI=1S/C3H7NO2S/c5-7(6)3-1-2-4-7/h4H,1-3H2 |
| InChIKey | XGYCWCIGCYGQFU-UHFFFAOYSA-N |
| SMILES | S1(=O)(=O)CCCN1 |
Description and Uses
Propane Sultam is a reactant used in the synthesis of orally bioavailable hebatits B caspid inhibitors as well as in the preparation of cryptochrome imhibitors as antidiabetic agents.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| WGK Germany | 3 |
| HS Code | 2934999090 |






![(E)-1-((3aS,6R,7aR)-8,8-Dimethyl-2,2-dioxidohexahydro-1H-3a,6-methanobenzo[c]isothiazol-1-yl)but-2-en-1-one](https://img.chemicalbook.com/CAS/GIF/94668-55-0.gif)