BD8971631
trans-Methyl 4-(hydroxymethyl)cyclohexanecarboxylate , 97% , 110928-44-4
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB83.20 | In Stock |
|
| 250mg | RMB151.20 | In Stock |
|
| 1g | RMB290.40 | In Stock |
|
| 5g | RMB884.00 | In Stock |
|
| 25g | RMB2956.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 251℃ |
| Density | 1.058 |
| Flash point: | 57℃ |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly, Sonicated) |
| form | Oil |
| pka | 15.05±0.10(Predicted) |
| color | Colourless |
| InChI | InChI=1S/C9H16O3/c1-12-9(11)8-4-2-7(6-10)3-5-8/h7-8,10H,2-6H2,1H3/t7-,8- |
| InChIKey | KOGYKIDJFOMAOF-ZKCHVHJHSA-N |
| SMILES | [C@@H]1(C(OC)=O)CC[C@@H](CO)CC1 |
Description and Uses
Methyl 4-(Hydroxymethyl)cyclohexanecarboxylate is a useful reagent in the synthesis and biopharmaceutical evaluation of imatinib analogs.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H335-H302+H312+H332-H315 |
| Precautionary statements | P280-P301+P312-P362+P364 |
| HS Code | 2918199890 |
