BD8979631
2-Amino-3-(trifluoromethyl)benzonitrile , 98% , 58458-14-3
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB62.40 | In Stock |
|
| 1g | RMB156.00 | In Stock |
|
| 5g | RMB561.60 | In Stock |
|
| 25g | RMB1591.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 62-65 °C |
| Boiling point: | 263.9±40.0 °C(Predicted) |
| Density | 1.37±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C(protect from light) |
| form | Solid |
| pka | -1.32±0.10(Predicted) |
| Appearance | Light yellow to yellow Solid |
| InChI | InChI=1S/C8H5F3N2/c9-8(10,11)6-3-1-2-5(4-12)7(6)13/h1-3H,13H2 |
| InChIKey | UHOSMRSMWHLHJO-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=CC(C(F)(F)F)=C1N |
| CAS DataBase Reference | 58458-14-3(CAS DataBase Reference) |
Description and Uses
2-Amino-3-trifluoromethylbenzonitrile is a useful intermediate for the preparation of chloro and trifluoromethyl derivatives of benzisothiazoles.
Safety
| Symbol(GHS) |   GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H330-H314-H227-H290 |
| Precautionary statements | P501-P260-P210-P234-P271-P264-P280-P284-P370+P378-P390-P303+P361+P353-P301+P330+P331-P363-P304+P340+P310-P305+P351+P338+P310-P403+P233-P403+P235-P406-P405 |
| Hazard Codes | Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | 3439 |
| Hazard Note | Irritant |
| HS Code | 2926907090 |
