BD8982431
(1R,3S)-3-((tert-Butoxycarbonyl)amino)cyclopentanecarboxylic acid , 95% , 161660-94-2
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB76.00 | In Stock |
|
| 1g | RMB123.20 | In Stock |
|
| 5g | RMB553.60 | In Stock |
|
| 10g | RMB1009.60 | In Stock |
|
| 25g | RMB2223.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 96.1 °C |
| Boiling point: | 371.18°C (rough estimate) |
| Density | 1.1482 (rough estimate) |
| refractive index | 1.4490 (estimate) |
| storage temp. | 2-8°C |
| form | Powder |
| pka | 4.62±0.40(Predicted) |
| color | White |
| InChI | InChI=1S/C11H19NO4/c1-11(2,3)16-10(15)12-8-5-4-7(6-8)9(13)14/h7-8H,4-6H2,1-3H3,(H,12,15)(H,13,14)/t7-,8+/m1/s1 |
| InChIKey | RNJQBGXOSAQQDG-SFYZADRCSA-N |
| SMILES | [C@@H]1(C(O)=O)CC[C@H](NC(OC(C)(C)C)=O)C1 |
Description and Uses
(1R,3S)-3-[(tert-Butoxycarbonyl)amino]cyclopentanecarboxylic Acid is used as a reagent in the sunthesis of Jak1 kinase inhibitors stemming from tricyclic pyrrolopyrazines.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29223900 |




![(1<I>S</I>)<WBR>-<WBR>(+)<WBR>-<WBR>2-<WBR>Azabicyclo[2.2.1]<WBR>hept-<WBR>5-<WBR>en-<WBR>3-<WBR>one](https://img.chemicalbook.com/CAS/GIF/130931-83-8.gif)
![(1S,4R)-tert-butyl 3-oxo-2-azabicyclo[2.2.1]hept-5-ene-2-carboxylate](https://img.chemicalbook.com/CAS/20180531/GIF/200002-41-1.gif)

