BD8991331
4-Methoxy-N-(4-methoxyphenyl)-N-phenylaniline , 95% , 20440-94-2
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB24.00 | In Stock |
|
| 250mg | RMB28.80 | In Stock |
|
| 1g | RMB40.80 | In Stock |
|
| 5g | RMB136.00 | In Stock |
|
| 10g | RMB260.00 | In Stock |
|
| 25g | RMB631.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 103 °C |
| Boiling point: | 453.4±30.0 °C(Predicted) |
| Density | 1.136 |
| storage temp. | Sealed in dry,Room Temperature |
| pka | -1.74±0.50(Predicted) |
| Appearance | Off-white to light yellow Solid |
| InChI | InChI=1S/C20H19NO2/c1-22-19-12-8-17(9-13-19)21(16-6-4-3-5-7-16)18-10-14-20(23-2)15-11-18/h3-15H,1-2H3 |
| InChIKey | ZJPTYHDCQPDNBH-UHFFFAOYSA-N |
| SMILES | C1(N(C2=CC=C(OC)C=C2)C2=CC=CC=C2)=CC=C(OC)C=C1 |
Description and Uses
4-Methoxy-N-(4-methoxyphenyl) (also known as 4,4'-dimethoxytriphenylamine) is a synthetic material intermediate, which can be used to prepare hole transport materials (HTMs) for perovskite solar cells (PSCs).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
