BD9000855
HO-PEG-NH2 , 95%verageM.W.2,000 , 32130-27-1
Synonym(s):
Aminopolyethylene glycol;Aminopolyethylene glycol 10,000;Aminopolyethylene glycol 5,000
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB213.60 | In Stock |
|
| 250mg | RMB320.00 | In Stock |
|
| 1g | RMB799.20 | In Stock |
|
| 5g | RMB2876.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| refractive index | 1.474 |
| Flash point: | 278 °C |
| storage temp. | -20°C |
| form | solid or viscous liquid |
| Specific Gravity | 1.15 |
| Appearance | Off-white to yellow Solid |
| α-end | amine |
| Ω-end | hydroxyl |
| InChI | 1S/C2H7NO/c3-1-2-4/h4H,1-3H2 |
| InChIKey | NCWDZRVHWBSGGG-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCN)OC |
Description and Uses
m-PEG48-amine is a aqueous soluble PEG linker containing an amino group.it can react with carboxylic acids, activated NHS esters, carbonyls (ketone, aldehyde) etc. The hydrophilic PEG spacer increases solubility in aqueous media.
Reactant for:• ;Preparation of pH responsive self-healing hydrogels formed by boronate-catechol complexation1• ;Preparation of core-clickable PEG-branch-azide bivalent-bottle-brush polymers by ROMP2• ;Preparation of drug-loaded bivalent-bottle-brush polymers by graft-through ROMP3
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 10-23 |
| HS Code | 39072090 |
| Storage Class | 11 - Combustible Solids |







