BD9027831
1,4-Dibromo-2,3-dimethylbenzene , 97% , 75024-22-5
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB41.60 | In Stock |
|
| 1g | RMB92.00 | In Stock |
|
| 5g | RMB354.40 | In Stock |
|
| 10g | RMB644.00 | In Stock |
|
| 25g | RMB1567.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 232 °C |
| Boiling point: | 118-121 °C(Press: 15 Torr) |
| Density | 1.710±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C8H8Br2/c1-5-6(2)8(10)4-3-7(5)9/h3-4H,1-2H3 |
| InChIKey | IVJJDBCZDJFMNZ-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=C(Br)C(C)=C1C |
Description and Uses
1,4-Dibromo-2,3-dimethylbenzene is an organic compound containing two bromine atoms and two methyl groups on its benzene ring structure, which can be used to prepare pharmaceutical and chemical intermediates.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
