PRODUCT Properties
| Melting point: | 148-151°C |
| Boiling point: | 317.1±17.0 °C(Predicted) |
| Density | 1.635±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | solid |
| pka | 3.66±0.36(Predicted) |
| color | White |
| Water Solubility | Insoluble in water. |
| InChI | InChI=1S/C8H7BrO2/c9-5-6-3-1-2-4-7(6)8(10)11/h1-4H,5H2,(H,10,11) |
| InChIKey | QSLMPDKYTNEMFQ-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC=C1CBr |
| CAS DataBase Reference | 7115-89-1 |
Description and Uses
2-(Bromomethyl)benzoic acid contains bi functional groups such as benzylic bromide and carboxylic acid are involved in nucleophilic reactions and esterification reactions respectively.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314-H318 |
| Precautionary statements | P280-P305+P351+P338-P309-P310a |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN3261 |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29163990 |







