BD9099547
(3,3-Diethoxyprop-1-en-1-yl)benzene , 95% , 7148-78-9
CAS NO.:7148-78-9
Empirical Formula: C13H18O2
Molecular Weight: 206.28
MDL number: MFCD00672803
EINECS: 230-467-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB57.60 | In Stock |
|
| 10g | RMB97.60 | In Stock |
|
| 25g | RMB195.20 | In Stock |
|
| 100g | RMB644.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 126-127 °C(Press: 10 Torr) |
| Density | 0.984±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| Odor | at 100.00 %. spicy cinnamon |
| Appearance | Colorless to off-white Liquid |
| Odor Type | spicy |
| JECFA Number | 648 |
| InChI | InChI=1S/C13H18O2/c1-3-14-13(15-4-2)11-10-12-8-6-5-7-9-12/h5-11,13H,3-4H2,1-2H3 |
| InChIKey | VYKDEWVAUWARRX-UHFFFAOYSA-N |
| SMILES | C1(C=CC(OCC)OCC)=CC=CC=C1 |
| LogP | 3.253 (est) |
| EPA Substance Registry System | Benzene, (3,3-diethoxy-1-propenyl)- (7148-78-9) |
Description and Uses
CINNAMALDEHYDE DIETHYL ACETAL is used occasionally in perfume formulations as a modifier and "new" note in modern-aldehydic or spicy-fruity fragrance types.
Stable in soap, but does not contribute much
"spice" odor and can not be considered a suitable substitute for the aldehyde.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| TSCA | TSCA listed |





