BD9100847
1-Amino-2-methylanthracene-9,10-dione , 98% , 82-28-0
Synonym(s):
1-Amino-2-methylanthraquinone
CAS NO.：82-28-0
Empirical Formula: C15H11NO2
Molecular Weight: 237.25
MDL number: MFCD00001220
EINECS: 201-408-3
| Pack Size | Price | Stock | Quantity |
| 5g | RMB144.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 204-206 °C(lit.) |
| Boiling point: | 379.79°C (rough estimate) |
| Density | 1.1469 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| Colour Index | 60700 |
| pka | -0.53±0.20(Predicted) |
| color | Orange to Amber to Dark red |
| Water Solubility | 332.2ug/L(25 ºC) |
| Stability: | Stable. Incompatible with strong oxidizing agents, mineral acids. |
| Major Application | cleaning products cosmetics environmental food and beverages personal care |
| InChI | 1S/C15H11NO2/c1-8-6-7-11-12(13(8)16)15(18)10-5-3-2-4-9(10)14(11)17/h2-7H,16H2,1H3 |
| InChIKey | ZLCUIOWQYBYEBG-UHFFFAOYSA-N |
| SMILES | Cc1ccc2C(=O)c3ccccc3C(=O)c2c1N |
| CAS DataBase Reference | 82-28-0(CAS DataBase Reference) |
| IARC | 3 (Vol. 27, Sup 7) 1987 |
| EPA Substance Registry System | 1-Amino-2-methylanthraquinone (82-28-0) |
Description and Uses
Disperse Orange 11 is a dye used in imaging studies including confocal transmission imaging microscopy or polymers. Dyes and metabolites, Environmental Testing
Safety
| Symbol(GHS) |  GHS08 |
| Signal word | Warning |
| Hazard statements | H351 |
| Precautionary statements | P201-P202-P280-P308+P313-P405-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| RTECS | CB5740000 |
| F | 10-21 |
| TSCA | TSCA listed |
| HS Code | 2922.39.4500 |
| HazardClass | IRRITANT |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Carc. 2 |
| Hazardous Substances Data | 82-28-0(Hazardous Substances Data) |
