BD9103131
8-Bromo-1,2,3,4-tetrahydroisoquinoline , 97% , 75416-51-2
CAS NO.：75416-51-2
Empirical Formula: C9H10BrN
Molecular Weight: 212.09
MDL number: MFCD10001500
EINECS: 817-034-4
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB98.40 | In Stock |
|
| 250mg | RMB169.60 | In Stock |
|
| 1g | RMB359.20 | In Stock |
|
| 5g | RMB1273.60 | In Stock |
|
| 10g | RMB2459.20 | In Stock |
|
| 25g | RMB5460.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 294℃ |
| Density | 1.428 |
| Flash point: | 132℃ |
| storage temp. | 2-8°C(protect from light) |
| pka | 8.88±0.20(Predicted) |
| Appearance | Off-white to yellow Solid-liquid mixture |
| InChI | InChI=1S/C9H10BrN/c10-9-3-1-2-7-4-5-11-6-8(7)9/h1-3,11H,4-6H2 |
| InChIKey | KHWGHUZYXQPIKA-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC=C2Br)CCN1 |
Description and Uses
8-Bromo-1,2,3,4-tetrahydroisoquinoline is a useful intermediate for organic synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
