BD9107331
                    6-Bromo-3,4-dihydro-2H-benzo[b][1,4]oxazine , 98% , 105655-01-4
| Pack Size | Price | Stock | Quantity | 
| 250mg | RMB116.80 | In Stock |  | 
| 1g | RMB286.40 | In Stock |  | 
| 5g | RMB920.00 | In Stock |  | 
| 25g | RMB3232.00 | In Stock |  | 
| 100g | RMB12580.00 | In Stock |  | 
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Boiling point: | 296.4±40.0 °C(Predicted) | 
| Density | 1.534±0.06 g/cm3(Predicted) | 
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature | 
| form | solid | 
| pka | 3.59±0.20(Predicted) | 
| Appearance | Light brown to orange Solid-liquid mixture | 
| InChI | InChI=1S/C8H8BrNO/c9-6-1-2-8-7(5-6)10-3-4-11-8/h1-2,5,10H,3-4H2 | 
| InChIKey | RWKBNMSHIJBNAO-UHFFFAOYSA-N | 
| SMILES | O1C2=CC=C(Br)C=C2NCC1 | 
Description and Uses
6-Bromo-3,4-dihydro-2H-1,4-benzoxazine is a reactant used for the synthesis of N-dichloroacetyl-3,4-dihydro-2H-1,4-benzoxazine derivatives.
Safety
| Symbol(GHS) |  GHS07 | 
| Signal word | Warning | 
| Hazard statements | H315-H319-H335-H302 | 
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a | 
| Hazard Codes | Xn | 
| Risk Statements | 22 | 
| HS Code | 2934999090 | 

![6-Bromo-3,4-dihydro-2H-benzo[b][1,4]oxazine](https://img.chemicalbook.com/CAS/GIF/105655-01-4.gif)

![6-Bromo-2,4-dichloropyrido[2,3-d]pyrimidine](https://img.chemicalbook.com/CAS/20180703/GIF/1234616-70-6.gif)
![6-Bromo-2-methylimidazo[1,2-a]pyrazine](https://img.chemicalbook.com/CAS/GIF/1159811-97-8.gif)