BD9113531
Methyl DL-pyroglutamate , 97% , 54571-66-3
CAS NO.：54571-66-3
Empirical Formula: C6H9NO3
Molecular Weight: 143.14
MDL number: MFCD03844651
EINECS: 259-233-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB40.80 | In Stock |
|
| 10g | RMB79.20 | In Stock |
|
| 25g | RMB192.80 | In Stock |
|
| 100g | RMB665.60 | In Stock |
|
| 500g | RMB2071.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 21-23℃ lit. |
| Boiling point: | 133-135℃/1mm |
| Density | 1.204 |
| refractive index | 1.4850 |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Solid |
| pka | 14.65±0.40(Predicted) |
| color | Colorless to Brown |
| InChI | InChI=1S/C6H9NO3/c1-10-6(9)4-2-3-5(8)7-4/h4H,2-3H2,1H3,(H,7,8)/t4-/m0/s1 |
| InChIKey | HQGPKMSGXAUKHT-BYPYZUCNSA-N |
| SMILES | C(OC)(=O)[C@@H]1CCC(=O)N1 |
Description and Uses
Methyl 5-Oxopyrrolidine-2-carboxylate, a purinoceptor antagonists in humans.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| HS Code | 2933790090 |
