BD9163831
Z-Chg-OH , 97% , 69901-75-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB56.80 | In Stock |
|
| 10g | RMB96.80 | In Stock |
|
| 25g | RMB201.60 | In Stock |
|
| 100g | RMB697.60 | In Stock |
|
| 500g | RMB3096.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 111-114°C |
| Boiling point: | 492.1±38.0 °C(Predicted) |
| Density | 1.200±0.06 g/cm3(Predicted) |
| vapor pressure | 0Pa at 25℃ |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| pka | 3.99±0.10(Predicted) |
| form | Solid |
| color | White |
| InChI | InChI=1/C16H21NO4/c18-15(19)14(13-9-5-2-6-10-13)17-16(20)21-11-12-7-3-1-4-8-12/h1,3-4,7-8,13-14H,2,5-6,9-11H2,(H,17,20)(H,18,19)/t14-/s3 |
| InChIKey | CUSYTUPJAYLNFQ-WDHUHKLTNA-N |
| SMILES | [C@H](C1CCCCC1)(C(=O)O)NC(=O)OCC1C=CC=CC=1 |&1:0,r| |
| LogP | 1.7 at 25℃ and pH2.5 |
| CAS DataBase Reference | 69901-75-3(CAS DataBase Reference) |
Description and Uses
Cbz-Cyclohexyl-L-glycine is a gylicine derivative used in the preparation of peptides as inhibitors of serine proteases, particularly hepatitis C virus NS3-NS4A protease.
Safety
| Symbol(GHS) |  GHS08 |
| Signal word | Warning |
| Hazard statements | H373 |
| Precautionary statements | P260-P314-P501 |
