BD9172231
2,5-Dihydroxyterephthalaldehyde , 95% , 1951-36-6
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB79.20 | In Stock |
|
| 250mg | RMB148.00 | In Stock |
|
| 1g | RMB466.40 | In Stock |
|
| 5g | RMB2147.20 | In Stock |
|
| 10g | RMB3936.00 | In Stock |
|
| 25g | RMB7872.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 262℃ |
| Boiling point: | 297.6±40.0 °C(Predicted) |
| Density | 1.515±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 7.88±0.23(Predicted) |
| Appearance | Light yellow to yellow Solid |
| InChI | InChI=1S/C8H6O4/c9-3-5-1-7(11)6(4-10)2-8(5)12/h1-4,11-12H |
| InChIKey | PIWMYUGNZBJTID-UHFFFAOYSA-N |
| SMILES | C1(C=O)=CC(O)=C(C=O)C=C1O |
Description and Uses
1. Synthesis of bis(N-salicylidene-aniline)s BSAN 2. COF applications
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H335-H319-H302 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P270-P301+P312-P330-P501-P264-P280-P305+P351+P338-P337+P313P |
| HS Code | 2912210000 |
