BD9175547
6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinoline , 97% , 675576-26-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB1002.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 179-184°C |
| Boiling point: | 397.5±15.0 °C(Predicted) |
| Density | 1.10±0.1 g/cm3 (20 ºC 760 Torr) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | solid |
| pka | 5.03±0.14(Predicted) |
| Appearance | Off-white to light yellow Solid |
| InChI | 1S/C15H18BNO2/c1-14(2)15(3,4)19-16(18-14)13-6-5-12-10-17-8-7-11(12)9-13/h5-10H,1-4H3 |
| InChIKey | LFALMDZWCMSBFO-UHFFFAOYSA-N |
| SMILES | CC1(C)OB(OC1(C)C)c2ccc3cnccc3c2 |
Description and Uses
Useful boron compound for Suzuki coupling.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
