BD9193631
Fmoc-N-Me-L-Met-OH , 95% , 84000-12-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB120.80 | In Stock |
|
| 1g | RMB313.60 | In Stock |
|
| 5g | RMB1136.00 | In Stock |
|
| 25g | RMB3246.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 150-155°C |
| Boiling point: | 587.6±50.0 °C(Predicted) |
| Density | 1.265±0.06 g/cm3(Predicted) |
| storage temp. | Store below +30°C. |
| form | powder or crystals |
| pka | 3.73±0.10(Predicted) |
| color | white to beige |
| optical activity | Consistent with structure |
| Major Application | peptide synthesis |
| InChI | 1S/C21H23NO4S/c1-22(19(20(23)24)11-12-27-2)21(25)26-13-18-16-9-5-3-7-14(16)15-8-4-6-10-17(15)18/h3-10,18-19H,11-13H2,1-2H3,(H,23,24)/t19-/m0/s1 |
| InChIKey | SPYUJXKMEJUAOI-IBGZPJMESA-N |
| SMILES | CSCC[C@H](N(C)C(=O)OCC1c2ccccc2-c3ccccc13)C(O)=O |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| WGK Germany | 3 |
| HS Code | 2930 90 98 |
| Storage Class | 11 - Combustible Solids |






