BD9239347
cis-4-((2-Amino-3,5-dibromobenzyl)amino)cyclohexanol , 97% , 107814-37-9
CAS NO.:107814-37-9
Empirical Formula: C13H18Br2N2O
Molecular Weight: 378.1
MDL number:
EINECS: 200-158-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB8608.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 56-61oC |
| Boiling point: | 468.6±45.0 °C(Predicted) |
| Density | 1.70±0.1 g/cm3(Predicted) |
| storage temp. | Refrigerator |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 15.12±0.40(Predicted) |
| color | Colourless to Beige |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C13H18Br2N2O/c14-9-5-8(13(16)12(15)6-9)7-17-10-1-3-11(18)4-2-10/h5-6,10-11,17-18H,1-4,7,16H2/t10-,11+ |
| InChIKey | JBDGDEWWOUBZPM-PHIMTYICSA-N |
| SMILES | [C@@H]1(O)CC[C@H](NCC2=CC(Br)=CC(Br)=C2N)CC1 |
Description and Uses
cis-Ambroxol is the cis-isomeric impurity of Ambroxol (A575905). cis-Ambroxol is a metabolite Bromhexine (B678600).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |





![Methyl3-[4-[2-hydroxy-3-[[2-hydroxy-3-[4-(3-methoxy-3-oxopropyl)phenoxy]propyl]-propan-2-ylamino]propoxy]phenyl]propanoate](https://img.chemicalbook.com/CAS/20200611/GIF/98903-90-3.gif)
