BD9240831
8-Hydroxyquinoline-5-carbaldehyde , 95% , 2598-30-3
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB208.00 | In Stock |
|
| 250mg | RMB357.60 | In Stock |
|
| 1g | RMB1049.60 | In Stock |
|
| 5g | RMB3480.00 | In Stock |
|
| 25g | RMB10800.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 178 °C |
| Boiling point: | 383.1±22.0 °C(Predicted) |
| Density | 1.364±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 3.88±0.10(Predicted) |
| color | Green |
| InChI | InChI=1S/C10H7NO2/c12-6-7-3-4-9(13)10-8(7)2-1-5-11-10/h1-6,13H |
| InChIKey | LIADJWREMDHKHQ-UHFFFAOYSA-N |
| SMILES | N1C2C(=C(C=O)C=CC=2O)C=CC=1 |
Description and Uses
8-Hydroxyquinoline-5-carbaldehyde is used in preparation of Polycyclic compounds.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H335-H319 |
| Precautionary statements | P264-P270-P301+P312-P330-P501-P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| target organs | Respiratory system |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






![2(1H)-Quinolinone, 8-hydroxy-5-[(1R,2R)-1-hydroxy-2-[(1-methylethyl)amino]butyl]-, rel-](https://img.chemicalbook.com/CAS/20200611/GIF/94198-40-0.gif)