BD9266631
(2S)-2-((tert-Butoxycarbonyl)amino)-2-(3-hydroxyadamantan-1-yl)acetic acid , 97% , 361442-00-4
CAS NO.:361442-00-4
Empirical Formula: C17H27NO5
Molecular Weight: 325.4
MDL number: MFCD16660445
EINECS: 700-361-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB30.40 | In Stock |
|
| 1g | RMB41.60 | In Stock |
|
| 5g | RMB138.40 | In Stock |
|
| 10g | RMB268.00 | In Stock |
|
| 25g | RMB602.40 | In Stock |
|
| 100g | RMB2337.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >230oC (dec.) |
| Boiling point: | 497.3±20.0 °C(Predicted) |
| Density | 1.296 |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly, Heated), DMSO (Slightly), Methanol (Slightly) |
| pka | 3.93±0.10(Predicted) |
| form | Solid |
| color | White |
| optical activity | Consistent with structure |
| InChI | InChI=1/C17H27NO5/c1-15(2,3)23-14(21)18-12(13(19)20)16-5-10-4-11(6-16)8-17(22,7-10)9-16/h10-12,22H,4-9H2,1-3H3,(H,18,21)(H,19,20)/t10,11,12-,16,17/s3 |
| InChIKey | UKCKDSNFBFHSHC-ZSJNFVKUNA-N |
| SMILES | CC(OC(N[C@@H](C12CC3CC(C1)(CC(C3)C2)O)C(=O)O)=O)(C)C |&1:5,r| |
| LogP | 0.55 |
Description and Uses
Boc-3-hydroxy-1-adamantyl-D-glycine is used in the preparation of a Saxagliptin intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H312-H332 |
| Precautionary statements | P261-P264-P270-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P330-P362-P403+P233-P501 |




![(1S,3S,5S)-tert-Butyl 3-carbamoyl-2-azabicyclo[3.1.0]hexane-2-carboxylate](https://img.chemicalbook.com/CAS/GIF/361440-67-7.gif)

