BD9273931
1,1'-(((2-Hydroxypropane-1,3-diyl)bis(oxy))bis(2-hydroxy-6,1-phenylene))diethanone , 95% , 16150-44-0
CAS NO.:16150-44-0
Empirical Formula: C19H20O7
Molecular Weight: 360.36
MDL number: MFCD01673219
EINECS: 240-302-1
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB352.80 | In Stock |
|
| 250mg | RMB599.20 | In Stock |
|
| 1g | RMB1556.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 168℃ (chloroform hexane ) |
| Boiling point: | 574.4±45.0 °C(Predicted) |
| Density | 1.321±0.06 g/cm3 (20 ºC 760 Torr) |
| storage temp. | 2-8°C |
| solubility | soluble in IPA |
| form | Solid |
| pka | 9.42±0.10(Predicted) |
| color | Green |
| Major Application | pharmaceutical |
| InChI | 1S/C19H20O7/c1-11(20)18-14(23)5-3-7-16(18)25-9-13(22)10-26-17-8-4-6-15(24)19(17)12(2)21/h3-8,13,22-24H,9-10H2,1-2H3 |
| InChIKey | RUOPAUDVYRHXDB-UHFFFAOYSA-N |
| SMILES | O(CC(O)COc2c(c(ccc2)O)C(=O)C)c1c(c(ccc1)O)C(=O)C |
Description and Uses
1,3-Bis(2-acetyl-3-hydroxyphenoxy)-2-hydroxypropane-D5 is a labelled analogue of 1,3-Bis(2-acetyl-3-hydroxyphenoxy)-2-hydroxypropane (B400180).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P330-P332+P313-P337+P313-P362-P403+P233-P405-P501 |
| WGK Germany | WGK 3 |
| HS Code | 2914500000 |
| Storage Class | 13 - Non Combustible Solids |
| Toxicity | mouse,LD50,intraperitoneal,825mg/kg (825mg/kg),European Journal of Medicinal Chemistry--Chimie Therapeutique. Vol. 22, Pg. 153, 1987. |







