BD9284031
3,3-Diethoxy-1-propanol , 98% , 16777-87-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB128.00 | In Stock |
|
| 5g | RMB453.60 | In Stock |
|
| 10g | RMB760.80 | In Stock |
|
| 25g | RMB1640.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 90-93 °C/14 mmHg (lit.) |
| Density | 0.941 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 196 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Liquid |
| pka | 15.05±0.10(Predicted) |
| color | Clear colorless |
| InChI | InChI=1S/C7H16O3/c1-3-9-7(5-6-8)10-4-2/h7-8H,3-6H2,1-2H3 |
| InChIKey | ASERXEZXVIJBRO-UHFFFAOYSA-N |
| SMILES | C(O)CC(OCC)OCC |
| LogP | 0.789 (est) |
Description and Uses
3,3-Diethoxy-1-propanol was used in the synthesis of α-acetal-poly(ethylene glycol) via reaction with potassium napthalide and ethylene oxide inside an UniLab Glovebox.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H335-H319 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| PPE | Eyeshields, Gloves, multi-purpose combination respirator cartridge (US) |
| WGK Germany | 3 |
| HS Code | 29094980 |
| Storage Class | 10 - Combustible liquids |







