BD9307431
N-(4-Aminophenyl)-N-methyl-2-(4-methylpiperazin-1-yl)acetamide , 97% , 262368-30-9
CAS NO.:262368-30-9
Empirical Formula: C14H22N4O
Molecular Weight: 262.35
MDL number: MFCD12457658
EINECS: 919-251-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB20.00 | In Stock |
|
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB81.60 | In Stock |
|
| 10g | RMB148.80 | In Stock |
|
| 25g | RMB356.00 | In Stock |
|
| 100g | RMB1340.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 152 - 154°C |
| Boiling point: | 434.8±40.0 °C(Predicted) |
| Density | 1.151 |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 7.43±0.10(Predicted) |
| color | Off-White to Pale Beige |
| InChI | InChI=1S/C14H22N4O/c1-16-7-9-18(10-8-16)11-14(19)17(2)13-5-3-12(15)4-6-13/h3-6H,7-11,15H2,1-2H3 |
| InChIKey | LBWNQLVDYPNHAV-UHFFFAOYSA-N |
| SMILES | N1(CC(N(C2=CC=C(N)C=C2)C)=O)CCN(C)CC1 |
Description and Uses
N-(4-Aminophenyl)-N-methyl-2-(4-methylpiperazin-1-yl)acetamide acts as a reagent for the preparation, angiokinase inhibitory, antitumor activity and pharmacokinectic properties of deuterated derivatives of nintedanib.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H315-H318-H412 |
| Precautionary statements | P501-P273-P264-P280-P302+P352-P362+P364-P332+P313-P305+P351+P338+P310 |
| WGK Germany | WGK 2 |
| HS Code | 2933998090 |
| Storage Class | 11 - Combustible Solids |







