BD9308147
2,6-Dibromo-4-cyanophenyloctanoate , 95% , 1689-99-2
CAS NO.：1689-99-2
Empirical Formula: C15H17Br2NO2
Molecular Weight: 403.11
MDL number: MFCD00055484
EINECS: 216-885-3
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB113.60 | In Stock |
|
| 1g | RMB278.40 | In Stock |
|
| 5g | RMB968.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 45-46°C |
| Boiling point: | 424.6±45.0 °C(Predicted) |
| Density | 1.6040 (rough estimate) |
| vapor pressure | 0Pa at 40℃ |
| refractive index | 1.6220 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | Solid |
| color | White to off-white |
| Water Solubility | 30μg/L at 20℃ |
| BRN | 2756636 |
| InChI | InChI=1S/C15H17Br2NO2/c1-2-3-4-5-6-7-14(19)20-15-12(16)8-11(10-18)9-13(15)17/h8-9H,2-7H2,1H3 |
| InChIKey | DQKWXTIYGWPGOO-UHFFFAOYSA-N |
| SMILES | C(OC1=C(Br)C=C(C#N)C=C1Br)(=O)CCCCCCC |
| LogP | 5.9 at 20℃ |
| CAS DataBase Reference | 1689-99-2(CAS DataBase Reference) |
| NIST Chemistry Reference | octanoic acid, 2,6-dibromo-4-cyanophenyl ester(1689-99-2) |
| EPA Substance Registry System | Bromoxynil octanoate (1689-99-2) |
Description and Uses
Selective contact foliage-applied herbicide used to control many broad-leaved weeds such as bindweed, chickweed and Veronica spp. in cereals.
Safety
| Symbol(GHS) |    GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H301+H331-H312-H317-H361d-H410 |
| Precautionary statements | P202-P273-P280-P301+P310-P302+P352+P312-P304+P340+P311 |
| Hazard Codes | T;N,N,T |
| Risk Statements | 22-23-43-50/53-63 |
| Safety Statements | 36/37-45-60-61-63 |
| RIDADR | 2588 |
| WGK Germany | 3 |
| RTECS | DI3325000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Hazardous Substances Data | 1689-99-2(Hazardous Substances Data) |
| Toxicity | LC50 (48-hour) for rainbow trout 150 μg/L (Hartley and Kidd, 1987), goldfish 460 μg/L and catfish 63 μg/L (Worthing and Hance, 1991); acute oral LD50 for rats 365 mg/kg (Hartley and Kidd, 1987). |
