BD9315431
6-Amino-4-hydroxy-2-mercaptopyrimidine , 98% , 1004-40-6
CAS NO.:1004-40-6
Empirical Formula: C4H5N3OS
Molecular Weight: 143.17
MDL number: MFCD00052384
EINECS: 213-722-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB75.20 | In Stock |
|
| 10g | RMB146.40 | In Stock |
|
| 25g | RMB193.60 | In Stock |
|
| 100g | RMB668.80 | In Stock |
|
| 500g | RMB2484.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300C (dec.) |
| Boiling point: | 246.5°C |
| Density | 1.397 (estimate) |
| refractive index | 1.7490 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | crystalline solid |
| pka | 7.92±0.20(Predicted) |
| color | Off-white |
| Water Solubility | 256.3mg/L(25 ºC) |
| InChI | InChI=1S/C4H5N3OS/c5-2-1-3(8)7-4(9)6-2/h1H,(H4,5,6,7,8,9) |
| InChIKey | YFYYRKDBDBILSD-UHFFFAOYSA-N |
| SMILES | C1(=S)NC(N)=CC(=O)N1 |
| CAS DataBase Reference | 1004-40-6(CAS DataBase Reference) |
| NIST Chemistry Reference | Uracil, 6-amino-2-thio-(1004-40-6) |
| EPA Substance Registry System | 6-Amino-2-thiouracil (1004-40-6) |
Description and Uses
LAbelled derivative of 6-Amino-2-thiouracil as novel, potent, and selective A3 adenosine receptor antagonists.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P271-P261-P280 |
| Hazard Codes | Xi |
| RTECS | UW0495000 |
| TSCA | TSCA listed |
| HS Code | 2933599590 |
| Toxicity | LD50 ipr-mus: 370 mg/kg ARZNAD 31,1713,81 |







