BD9354555
Uridine-5'-diphospho-a-D-galactosedisodiumsalt , 98% , 137868-52-1
Synonym(s):
UDP-Gal;UDP-galactose;Uridine[5’]diphospho[1]-α-D -galactopyranose disodium salt;Uridine-diphosphate-galactose disodium salt;UDP-Gal, Uridine-5?-diphosphogalactose, 2Na
CAS NO.:137868-52-1
Empirical Formula: C15H22N2Na2O17P2
Molecular Weight: 610.27
MDL number: MFCD00077895
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB442.40 | In Stock |
|
| 25mg | RMB751.20 | In Stock |
|
| 100mg | RMB1924.00 | In Stock |
|
| 250mg | RMB3271.20 | In Stock |
|
| 1g | RMB8832.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Flash point: | 27 °C |
| storage temp. | -20°C |
| solubility | H2O: 50 mg/mL, clear, colorless |
| form | White solid |
| color | White to Off-White |
| biological source | bovine milk rabbit muscle yeast |
| Water Solubility | water: 100mg/mL |
| BRN | 5374254 |
| Stability: | Hygroscopic |
| InChIKey | QSCAYUHBYHAJER-BGHHQIFUNA-N |
| SMILES | O[C@@H]1[C@@H]([C@@H](COP(O)(=O)OP(O)(=O)O[C@@H]2[C@@H]([C@@H](O)[C@@H](O)[C@@H](CO)O2)O)O[C@H]1N1C=CC(=O)NC1=O)O.[NaH] |&1:1,2,3,14,15,16,18,20,26,r| |
Description and Uses
Udp-alpha-d-galactose disodium salt is an endogenous nucleotide sugar. The compound is a donor substrate for galactosyltransferases employed in the biosynthesis of galactose-containing oligosaccharides.
UDP-D-galactose disodium salt is a uridine (U829910) derivative used in the synthesis of 5-CF3 UDP non-natural sugar nucleotides which are micromolar inhibitors of galactosyltransferases.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,R |
| Risk Statements | 36/37/38-10 |
| Safety Statements | 26-16 |
| RIDADR | UN 2910 7 |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 29400090 |
| Storage Class | 11 - Combustible Solids |







