BD9372931
6-Methyl-2-(p-tolyl)imidazo[1,2-a]pyridine , 98% , 88965-00-8
Synonym(s):
2-(4-Methylphenyl)-6-methylimidazo[1,2-a]pyridine;6-Methyl-2-(4-methylphenyl)imidazo[1,2-a]pyridine;OCT4-inducing compound 3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB38.40 | In Stock |
|
| 5g | RMB145.60 | In Stock |
|
| 25g | RMB555.20 | In Stock |
|
| 100g | RMB1820.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 205-207°C |
| Density | 1.09±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 7.07±0.50(Predicted) |
| form | Solid |
| color | White to Off-White |
| InChI | InChI=1S/C15H14N2/c1-11-3-6-13(7-4-11)14-10-17-9-12(2)5-8-15(17)16-14/h3-10H,1-2H3 |
| InChIKey | AWEWSJJCANQFRB-UHFFFAOYSA-N |
| SMILES | C12=NC(C3=CC=C(C)C=C3)=CN1C=C(C)C=C2 |
| CAS DataBase Reference | 88965-00-8(CAS DataBase Reference) |
Description and Uses
6-Methyl-2-(4-methylphenyl)-imidazo[1,2-a]pyridine is an impurity of Zolpidem (Z650000), a selective non-benzodiazepine GABAA receptor agonist.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |

![6-Methyl-2-(p-tolyl)imidazo[1,2-a]pyridine](https://img.chemicalbook.com/CAS/GIF/88965-00-8.gif)



