BD9374947
4-Methyl-2-(4-(trifluoromethyl)phenyl)thiazole-5-carboxylicacid , 97% , 144059-86-9
CAS NO.:144059-86-9
Empirical Formula: C12H8F3NO2S
Molecular Weight: 287.26
MDL number: MFCD00068105
EINECS: 200-589-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB168.00 | In Stock |
|
| 5g | RMB464.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 237 °C |
| Boiling point: | 413.2±55.0 °C(Predicted) |
| Density | 1.438±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 2.26±0.37(Predicted) |
| color | White to Off-White |
| Sensitive | Stench |
| InChI | 1S/C12H8F3NO2S/c1-6-9(11(17)18)19-10(16-6)7-2-4-8(5-3-7)12(13,14)15/h2-5H,1H3,(H,17,18) |
| InChIKey | DRFFZMPSUPHSJN-UHFFFAOYSA-N |
| SMILES | Cc1nc(sc1C(O)=O)-c2ccc(cc2)C(F)(F)F |
| CAS DataBase Reference | 144059-86-9(CAS DataBase Reference) |
Description and Uses
4-Methyl-2-(4-(trifluoromethyl)phenyl)thiazole-5-carboxylic Acid can be used to prepare pharmaceutical compositions.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,T |
| Risk Statements | 20/21/22-36/37/38-25 |
| Safety Statements | 22-36/37/39-37/39-26-45 |
| WGK Germany | WGK 3 |
| Hazard Note | Irritant/Stench |
| HS Code | 2934100090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |



![Ethyl 4-<WBR>methyl-<WBR>2-<WBR>[4-<WBR>(trifluoro-<WBR>methyl)<WBR>-<WBR>phenyl]<WBR>thiazole-<WBR>5-<WBR>carboxylate](https://img.chemicalbook.com/CAS/GIF/175277-03-9.gif)



