BD9388931
5-Bromo-2-hydroxybenzoic acid , 98% , 89-55-4
Synonym(s):
5-Bromo-2-hydroxybenzoic acid
CAS NO.:89-55-4
Empirical Formula: C7H5BrO3
Molecular Weight: 217.02
MDL number: MFCD00002455
EINECS: 201-917-0
| Pack Size | Price | Stock | Quantity |
| 5g | RMB24.00 | In Stock |
|
| 25g | RMB97.60 | In Stock |
|
| 100g | RMB374.40 | In Stock |
|
| 500g | RMB1537.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 159-162 °C (lit.) |
| Boiling point: | 338.1±32.0 °C(Predicted) |
| Density | 1.7097 (rough estimate) |
| refractive index | 1.4560 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Powder |
| pka | pK1:2.61 (25°C) |
| color | White to slightly beige |
| Water Solubility | Soluble |
| BRN | 2209121 |
| InChI | InChI=1S/C7H5BrO3/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3,9H,(H,10,11) |
| InChIKey | IEJOONSLOGAXNO-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(Br)=CC=C1O |
| CAS DataBase Reference | 89-55-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 5-Bromosalicylic acid(89-55-4) |
| EPA Substance Registry System | Benzoic acid, 5-bromo-2-hydroxy- (89-55-4) |
Description and Uses
5-Bromosalicylic acid may be employed as a starting reagent for the synthesis of honokiol, a biphenyl-type neolignan.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26-36 |
| WGK Germany | 3 |
| RTECS | VO1850000 |
| TSCA | TSCA listed |
| HS Code | 29182900 |
| Storage Class | 11 - Combustible Solids |




