BD9412631
(4R,5R,6S)-4-Nitrobenzyl 3-((diphenoxyphosphoryl)oxy)-6-((R)-1-hydroxyethyl)-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate , 97% , 90776-59-3
CAS NO.:90776-59-3
Empirical Formula: C29H27N2O10P
Molecular Weight: 594.51
MDL number: MFCD01318092
EINECS: 618-646-2
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB30.40 | In Stock |
|
| 1g | RMB72.80 | In Stock |
|
| 5g | RMB240.00 | In Stock |
|
| 10g | RMB408.00 | In Stock |
|
| 25g | RMB820.80 | In Stock |
|
| 100g | RMB2319.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 129-131C |
| Boiling point: | 722.4±60.0 °C(Predicted) |
| Density | 1.47±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 14.36±0.20(Predicted) |
| color | White to Off-White |
| InChIKey | STULDTCHQXVRIX-PIYXRGFCSA-N |
| SMILES | N12[C@@]([H])([C@@H]([C@H](O)C)C1=O)[C@@H](C)C(OP(OC1=CC=CC=C1)(OC1=CC=CC=C1)=O)=C2C(OCC1=CC=C([N+]([O-])=O)C=C1)=O |
| CAS DataBase Reference | 90776-59-3(CAS DataBase Reference) |
Description and Uses
A chemical compound.
Meropenem intermediate. A 1β-methyl carbapenem derivative as antibacterial agent.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |

![(4R,5R,6S)-4-Nitrobenzyl 3-((diphenoxyphosphoryl)oxy)-6-((R)-1-hydroxyethyl)-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate](https://img.chemicalbook.com/CAS/GIF/90776-59-3.gif)

![(3<i>S</i>,4<i>S</i>)-3-[(<i>R</i>)-1-(<i>tert</i>-Butyldimethylsilyloxy)ethyl]-4-[(<i>R</i>)-1-carboxyethyl]-2-azetidinone](https://img.chemicalbook.com/CAS/GIF/90776-58-2.gif)


