BD9417231
D-Tyrosinol hydrochloride , 95% , 40829-04-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB409.60 | In Stock |
|
| 1g | RMB1023.20 | In Stock |
|
| 5g | RMB3800.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 167 °C |
| alpha | 15 º (C=1, H2O 22 ºC) |
| storage temp. | Inert atmosphere,2-8°C |
| optical activity | [α]22/D +18°, c = 1 in H2O |
| Major Application | peptide synthesis |
| InChI | 1S/C9H13NO2.ClH/c10-8(6-11)5-7-1-3-9(12)4-2-7;/h1-4,8,11-12H,5-6,10H2;1H/t8-;/m1./s1 |
| InChIKey | PNGCRFWYSRUQTB-DDWIOCJRSA-N |
| SMILES | Cl[H].N[C@@H](CO)Cc1ccc(O)cc1 |
| CAS DataBase Reference | 40829-04-7(CAS DataBase Reference) |
Description and Uses
D-Tyrosinol hydrochloride is a useful reagent and reactant for organic reactions and synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| HS Code | 29299000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
