BD9426555
Diethoxy(methyl)(3-(oxiran-2-ylmethoxy)propyl)silane , 98% , 2897-60-1
Synonym(s):
(3-Glycidyloxypropyl)methyldiethoxysilane;[3-(2,3-Epoxypropoxy)propyl]methyldiethoxysilane
CAS NO.:2897-60-1
Empirical Formula: C11H24O4Si
Molecular Weight: 248.39
MDL number: MFCD00046995
EINECS: 220-780-8
| Pack Size | Price | Stock | Quantity |
| 25g | RMB24.80 | In Stock |
|
| 100g | RMB96.00 | In Stock |
|
| 500g | RMB361.60 | In Stock |
|
| 1000g | RMB611.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <0°C |
| Boiling point: | 122-126 °C5 mm Hg(lit.) |
| Density | 0.978 g/mL at 25 °C(lit.) |
| vapor pressure | 0-7910Pa at 25℃ |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| form | liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 0.978 |
| Water Solubility | 1.2-1000g/L at 20℃ |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| BRN | 121965 |
| InChI | 1S/C11H24O4Si/c1-4-14-16(3,15-5-2)8-6-7-12-9-11-10-13-11/h11H,4-10H2,1-3H3 |
| InChIKey | OTARVPUIYXHRRB-UHFFFAOYSA-N |
| SMILES | CCO[Si](C)(CCCOCC1CO1)OCC |
| LogP | -0.7-2.7 at 20℃ |
| CAS DataBase Reference | 2897-60-1(CAS DataBase Reference) |
| EPA Substance Registry System | 3-(Methyldiethoxysilyl)propyl glycidyl ether (2897-60-1) |
Description and Uses
(3-Glycidyloxypropyl)methyldiethoxysilane is an organo-functional silane that can be used as a coupling agent between inorganic fillers (powdered silicas, glass, fiberglass, ceramics, etc.) and a wide variety of polymers such as epoxy, melamine, phenolic and urethane resins, polystyrene plastic, acrylic sealants, butyl rubber and water soluble polymers that contain hydroxyl groups and/or primary or secondary amine groups.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-41 |
| Safety Statements | 26-36/39 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | TSCA listed |
| HS Code | 29319090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




![3-[Dimethoxy(methyl)silyl]propyl Methacrylate](https://img.chemicalbook.com/CAS/GIF/14513-34-9.gif)

