BD9437331
2-(4-Aminophenyl)-6-methylbenzothiazole , 95% , 92-36-4
CAS NO.:92-36-4
Empirical Formula: C14H12N2S
Molecular Weight: 240.32
MDL number: MFCD00005780
EINECS: 202-150-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB24.00 | In Stock |
|
| 1g | RMB28.80 | In Stock |
|
| 5g | RMB128.00 | In Stock |
|
| 10g | RMB206.40 | In Stock |
|
| 25g | RMB394.40 | In Stock |
|
| 100g | RMB957.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 191-196°C |
| Boiling point: | 434°C |
| Density | 1.1769 (rough estimate) |
| refractive index | 1.5700 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | ≥ 24mg/mL in DMSO |
| pka | 2.79±0.10(Predicted) |
| form | Flakes |
| color | Light yellow to green yellow |
| Water Solubility | <0.1 g/100 mL at 20 ºC |
| InChI | InChI=1S/C14H12N2S/c1-9-2-7-12-13(8-9)17-14(16-12)10-3-5-11(15)6-4-10/h2-8H,15H2,1H3 |
| InChIKey | XRTJYEIMLZALBD-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(C2=NC3=CC=C(C)C=C3S2)C=C1 |
| LogP | 3.56 at 25℃ |
| CAS DataBase Reference | 92-36-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzenamine, 4-(6-methyl-2-benzothiazolyl)-(92-36-4) |
| EPA Substance Registry System | 4-(6-Methyl-2-benzothiazolyl)aniline (92-36-4) |
Description and Uses
4-(6-Methyl-2-benzothiazolyl)benzeneamine is an important intermediate for dyes used in synthetic paper and can be further processed into dehydrothiolated p-toluidine monosulfonic acid, disulfonic acid and other dye intermediates.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H335-H315 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| Hazard Codes | Xi |
| RTECS | DL2820000 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 2934208090 |
| REACH Registrations | Inactive |







