BD9450755
Sodiumtetrathionatedihydrate , 98% , 13721-29-4
CAS NO.：13721-29-4
Empirical Formula: H4Na2O8S4
Molecular Weight: 306.27
MDL number: MFCD00150868
EINECS: 683-390-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB80.80 | In Stock |
|
| 5g | RMB281.60 | In Stock |
|
| 25g | RMB797.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Density | 2.1 g/mL at 25 °C(lit.) |
| storage temp. | 2-8°C |
| solubility | H2O: 50 mg/mL, slightly turbid, colorless |
| form | powder or crystals |
| Specific Gravity | 2.1 |
| PH | 3.8-6.0 (25℃, 0.1M in H2O) |
| Water Solubility | H2O: 50mg/mL, slightly turbid, colorless |
| InChI | InChI=1S/Na.H2O6S4.H2O.H/c;1-9(2,3)7-8-10(4,5)6;;/h;(H,1,2,3)(H,4,5,6);1H2; |
| InChIKey | HAEPBEMBOAIUPN-UHFFFAOYSA-L |
| SMILES | S(S(O)(=O)=O)SS(O)(=O)=O.[NaH].O |
| CAS DataBase Reference | 13721-29-4 |
Description and Uses
Sodium tetrathionate dihydrate may be used to compose the 0.2M Tris buffer in a study.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | XF6470000 |
| F | 10 |
| HS Code | 28429090 |
