![3',6'-Dichloro-3H-spiro[isobenzofuran-1,9'-xanthen]-3-one](https://img.chemicalbook.com/CAS/GIF/630-88-6.gif)
BD9458655
3',6'-Dichloro-3H-spiro[isobenzofuran-1,9'-xanthen]-3-one , 95% , 630-88-6
CAS NO.：630-88-6
Empirical Formula: C20H10Cl2O3
Molecular Weight: 369.2
MDL number: MFCD00037841
EINECS: 211-147-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB44.00 | In Stock |
|
| 1g | RMB96.80 | In Stock |
|
| 5g | RMB384.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 253-255 °C(lit.) |
| Boiling point: | 485.02°C (rough estimate) |
| Density | 1.2569 (rough estimate) |
| refractive index | 1.7360 (estimate) |
| solubility | almost transparency in hot Toluene |
| form | powder to crystal |
| color | Light yellow to Yellow to Orange |
| InChI | InChI=1S/C20H10Cl2O3/c21-11-5-7-15-17(9-11)24-18-10-12(22)6-8-16(18)20(15)14-4-2-1-3-13(14)19(23)25-20/h1-10H |
| InChIKey | LNBKJWCRFAZVLK-UHFFFAOYSA-N |
| SMILES | C12(C3=C(C=C(Cl)C=C3)OC3=C1C=CC(Cl)=C3)C1=C(C=CC=C1)C(=O)O2 |
| CAS DataBase Reference | 630-88-6(CAS DataBase Reference) |
| EPA Substance Registry System | Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 3',6'-dichloro- (630-88-6) |
Description and Uses
3,6-Dichlorofluorescein, a fluoresceina, can be used in the spot test for drugs containing amino and heterocyclic nitrogen[1].
Safety
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H411 |
| Precautionary statements | P264-P270-P301+P312-P330-P501 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26 |
| WGK Germany | 3 |
| HS Code | 29329990 |
