BD9461631
Methyl 5-bromo-1H-pyrazole-3-carboxylate , 97% , 1328893-17-9
CAS NO.：1328893-17-9
Empirical Formula: C5H5BrN2O2
Molecular Weight: 205.01
MDL number: MFCD23701497
EINECS: 814-396-5
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB41.60 | In Stock |
|
| 250mg | RMB77.60 | In Stock |
|
| 1g | RMB282.40 | In Stock |
|
| 5g | RMB1038.40 | In Stock |
|
| 10g | RMB1686.40 | In Stock |
|
| 25g | RMB3224.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 329.5±22.0 °C(Predicted) |
| Density | 1.781±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Chloroform (Sparingly), DMSO (Sparingly), Methanol (Slightly) |
| pka | 7.92±0.10(Predicted) |
| form | solid |
| color | Off-white |
| InChI | InChI=1S/C5H5BrN2O2/c1-10-5(9)3-2-4(6)8-7-3/h2H,1H3,(H,7,8) |
| InChIKey | RLDJSZKPUPTTNO-UHFFFAOYSA-N |
| SMILES | N1C(Br)=CC(C(OC)=O)=N1 |
Description and Uses
Methyl 5-Bromo-1H-pyrazole-3-carboxylate??can be used as DHODH inhibitors to treat diseases.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H335-H302+H312+H332-H315 |
| Precautionary statements | P280-P301+P312-P362+P364 |
| HS Code | 2933199090 |
