BD9467931
tert-Butyl 2-((4R,6S)-6-((E)-2-(4-(4-fluorophenyl)-6-isopropyl-2-(N-methylmethylsulfonamido)pyrimidin-5-yl)vinyl)-2,2-dimethyl-1,3-dioxan-4-yl)acetate , 97% , 289042-12-2
CAS NO.:289042-12-2
Empirical Formula: C29H40FN3O6S
Molecular Weight: 577.71
MDL number: MFCD08458343
EINECS: 1806241-263-5
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB24.80 | In Stock |
|
| 1g | RMB61.60 | In Stock |
|
| 5g | RMB190.40 | In Stock |
|
| 10g | RMB287.20 | In Stock |
|
| 25g | RMB576.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 153-155°C |
| Boiling point: | 673.3±65.0 °C(Predicted) |
| Density | 1.210 |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | -0.43±0.10(Predicted) |
| color | White to Off-White |
| Major Application | pharmaceutical small molecule |
| InChIKey | WIFPCEOJTKZGSA-UQECUQMJSA-N |
| SMILES | O1[C@H](/C=C/C2=C(C(C)C)N=C(N(C)S(C)(=O)=O)N=C2C2=CC=C(F)C=C2)C[C@H](CC(OC(C)(C)C)=O)OC1(C)C |
| CAS DataBase Reference | 289042-12-2(CAS DataBase Reference) |
Description and Uses
(4R,6S)-6-[(1E)-2-[4-(4-Fluorophenyl)-6-(1-methylethyl)-2-[methyl(methylsulfonyl)amino]-5-pyrimidinyl]ethenyl]-2,2-dimethyl-1,3-dioxane-4-acetic Acid 1,1-Dimethylethyl Ester (Rosuvastatin EP Impurity F) is a Rosuvastatin (R700500) intermediate as HMG-CoA reductase inhibitor.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| WGK Germany | WGK 3 |
| HS Code | 2935909550 |
| Storage Class | 13 - Non Combustible Solids |



![(3R,5S,6E)-7-[4-(4-Fluorophenyl)-6-isopropyl-2-[(methanesulfonyl) methylamino]pyrimidin-5-yl]-3,5-dihydroxyhept-6-enoic acid tert-butyl ester](https://img.chemicalbook.com/CAS/GIF/355806-00-7.gif)



