BD9504931
(S)-2-(((tert-Butyldimethylsilyl)oxy)diphenylmethyl)pyrrolidine , 98% , 864466-71-7
Synonym(s):
(S)-(−)-α,α-Diphenylprolinol tert-butyldimethylsilyl ether;(S)-2-[(tert-Butyldimethylsiloxy)diphenylmethyl]pyrrolidine
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB175.20 | In Stock |
|
| 250mg | RMB262.40 | In Stock |
|
| 1g | RMB720.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 71-73°C |
| Boiling point: | 445.2±35.0 °C(Predicted) |
| Density | 0.998±0.06 g/cm3(Predicted) |
| Flash point: | >110°C (>230°F) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | powder |
| pka | 10.12±0.10(Predicted) |
| Appearance | White to off-white Solid |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| BRN | 10368174 |
| InChI | 1S/C23H33NOSi/c1-22(2,3)26(4,5)25-23(21-17-12-18-24-21,19-13-8-6-9-14-19)20-15-10-7-11-16-20/h6-11,13-16,21,24H,12,17-18H2,1-5H3/t21-/m0/s1 |
| InChIKey | YJFSFDYMOMREQP-NRFANRHFSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC([C@@H]1CCCN1)(c2ccccc2)c3ccccc3 |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






![(2S)-1-[[2-Hydroxy-3-(trifluoromethyl)phenyl]methyl]-α,α-diphenyl-2-pyrrolidinemethanol](https://img.chemicalbook.com/CAS/20180703/GIF/1268725-95-6.gif)
