BD9511155
Oleicanhydride , 98% , 24909-72-6
Synonym(s):
cis-9-Octadecenoic anhydride
CAS NO.:24909-72-6
Empirical Formula: C36H66O3
Molecular Weight: 546.91
MDL number: MFCD00010459
EINECS: 246-522-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB197.60 | In Stock |
|
| 5g | RMB691.20 | In Stock |
|
| 25g | RMB2417.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 22-24 °C (lit.) |
| Boiling point: | 200-215 °C/11 mmHg (lit.) |
| Density | 0.88 |
| refractive index | 1.5500 (estimate) |
| Flash point: | >230 °F |
| storage temp. | −20°C |
| solubility | DMF: miscible; DMSO: miscible; Ethanol: 100 mg/ml; Ethanol:PBS(pH 7.2) (1:1): 0.5 mg/ml |
| form | liquid |
| color | Colorless to light yellow |
| BRN | 1730211 |
| InChIKey | OCNZHGHKKQOQCZ-CLFAGFIQSA-N |
| SMILES | O=C(CCCCCCC/C=C\CCCCCCCC)OC(CCCCCCC/C=C\CCCCCCCC)=O |
| CAS DataBase Reference | 24909-72-6(CAS DataBase Reference) |
| EPA Substance Registry System | 9-Octadecenoic acid (9Z)-, anhydride (24909-72-6) |
Description and Uses
Oleic anhydride is a biochemical reagent that can be used as a biological material or organic compound for life science related research.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | TSCA listed |
| HS Code | 2912.19.5000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



