BD9519831
2'-O-(2-Methoxyethyl)-guanosine , 97% , 473278-54-5
CAS NO.:473278-54-5
Empirical Formula: C13H19N5O6
Molecular Weight: 341.32
MDL number: MFCD02682962
EINECS: 1308068-626-2
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB167.20 | In Stock |
|
| 250mg | RMB268.80 | In Stock |
|
| 1g | RMB672.80 | In Stock |
|
| 5g | RMB1917.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 715.0±70.0 °C(Predicted) |
| Density | 1.81±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C(protect from light) |
| solubility | Acetonitrile: Slightly Soluble: 0.1-1 mg/ml DMSO: Sparingly Soluble: 1-10 mg/ml Water: Slightly Soluble: 0.1-1 mg/ml |
| pka | 13.20±0.70(Predicted) |
| form | Solid |
| color | White to off-white |
| InChI | InChI=1S/C13H19N5O6/c1-22-2-3-23-9-8(20)6(4-19)24-12(9)18-5-15-7-10(18)16-13(14)17-11(7)21/h5-6,8-9,12,19-20H,2-4H2,1H3,(H3,14,16,17,21)/t6-,8-,9-,12-/m1/s1 |
| InChIKey | DLLBJSLIKOKFHE-WOUKDFQISA-N |
| SMILES | OC[C@H]1O[C@@H](N2C3=C(C(NC(=N3)N)=O)N=C2)[C@H](OCCOC)[C@@H]1O |
Description and Uses
2'-O-(2-Methoxyethyl)-guanosine is a guanosine derivative isolated from the reaction of 2-aminoadenosine with methylsulfonyl chloride. 2'-O-(2-Methoxyethyl)-guanosine can be used as a building block for cross-linking oligonucleotides.
A guanosine derivative as building blocks for cross-linking oligonucleotides.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |







