BD9537447
7-(Diethylamino)-3-(thiophene-3-carbonyl)-2H-chromen-2-one , 97% , 77820-11-2
CAS NO.：77820-11-2
Empirical Formula: C18H17NO3S
Molecular Weight: 327.4
MDL number: MFCD00051376
EINECS: 145-632-3
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB121.60 | In Stock |
|
| 1g | RMB327.20 | In Stock |
|
| 5g | RMB1143.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 138-142 °C |
| Boiling point: | 533.3±50.0 °C(Predicted) |
| Density | 1.2165 (rough estimate) |
| refractive index | 1.7000 (estimate) |
| pka | 2.74±0.20(Predicted) |
| form | Solid |
| color | Light yellow to yellow |
| InChI | InChI=1S/C18H17NO3S/c1-3-19(4-2)13-8-7-12-10-14(18(21)22-15(12)11-13)17(20)16-6-5-9-23-16/h5-11H,3-4H2,1-2H3 |
| InChIKey | HSYRYXPRQYPBBQ-UHFFFAOYSA-N |
| SMILES | C1(=O)OC2=CC(N(CC)CC)=CC=C2C=C1C(C1SC=CC=1)=O |
| CAS DataBase Reference | 77820-11-2 |
Description and Uses
BioA-IN-1 (Compound 15) is an inhibitor of BioA, a key enzyme in the biotin synthesis pathway of Mycobacterium tuberculosis, with an IC50 value of 0.195 μM. BioA-IN-1 exhibits antibacterial activity but has no cytotoxicity[1].
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312+P330-P302+P352-P304+P340+P312-P305+P351+P338-P332+P313-P337+P313-P362-P403+P233-P405-P501 |
| Safety Statements | 24/25 |
| HS Code | 29349990 |
