BD9537655
2-(Trimethylsilyl)phenol , 98% , 15288-53-6
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB92.00 | In Stock |
|
| 1g | RMB244.00 | In Stock |
|
| 5g | RMB752.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | 2-8°C, stored under nitrogen |
| Appearance | Colorless to light yellow Liquid |
| InChI | InChI=1S/C9H14OSi/c1-11(2,3)9-7-5-4-6-8(9)10/h4-7,10H,1-3H3 |
| InChIKey | UIGHARXPLDWFHA-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=CC=C1[Si](C)(C)C |
Description and Uses
o-(Trimethylsilyl)phenol can be used to prepare samples for analysis by gas chromatography, mass spectrometry, or nuclear magnetic resonance spectroscopy.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
